C24H31BF2N4O5 — CID 154639199
[(1R)-1-[[(3S)-1-[2-cyano-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enoyl]pyrrolidin-3-yl]oxycarbonylamino]-2-phenylethyl]boronic acid (PubChem CID 154639199) has the molecular formula C24H31BF2N4O5 and a molecular weight of 504.34 g/mol. Its IUPAC name is [(1R)-1-[[(3S)-1-[2-cyano-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enoyl]pyrrolidin-3-yl]oxycarbonylamino]-2-phenylethyl]boronic acid.
| Compound Name | [(1R)-1-[[(3S)-1-[2-cyano-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enoyl]pyrrolidin-3-yl]oxycarbonylamino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 154639199 |
| Molecular Formula | C24H31BF2N4O5 |
| Molecular Weight | 504.34 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | [(1R)-1-[[(3S)-1-[2-cyano-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enoyl]pyrrolidin-3-yl]oxycarbonylamino]-2-phenylethyl]boronic acid |
| SMILES | CC(C)(C=C(C#N)C(=O)N1CC[C@H](OC(=O)N[C@@H](Cc2ccccc2)B(O)O)C1)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C24H31BF2N4O5/c1-23(2,31-11-9-24(26,27)16-31)13-18(14-28)21(32)30-10-8-19(15-30)36-22(33)29-20(25(34)35)12-17-6-4-3-5-7-17/h3-7,13,19-20,34-35H,8-12,15-16H2,1-2H3,(H,29,33)/t19-,20-/m0/s1 |
| InChIKey | REDNGLAZIFAVPR-PMACEKPBSA-N |
| XLogP | 1.51 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|