C25H26BN3O6 — CID 175039225
[2-(1-benzofuran-3-yl)-1-[1-[3-[2-cyano-3-(dimethylamino)-3-oxoprop-1-enyl]phenyl]ethoxycarbonylamino]ethyl]boronic acid (PubChem CID 175039225) has the molecular formula C25H26BN3O6 and a molecular weight of 475.31 g/mol. Its IUPAC name is [2-(1-benzofuran-3-yl)-1-[1-[3-[2-cyano-3-(dimethylamino)-3-oxoprop-1-enyl]phenyl]ethoxycarbonylamino]ethyl]boronic acid.
| Compound Name | [2-(1-benzofuran-3-yl)-1-[1-[3-[2-cyano-3-(dimethylamino)-3-oxoprop-1-enyl]phenyl]ethoxycarbonylamino]ethyl]boronic acid |
|---|---|
| PubChem CID | 175039225 |
| Molecular Formula | C25H26BN3O6 |
| Molecular Weight | 475.31 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | [2-(1-benzofuran-3-yl)-1-[1-[3-[2-cyano-3-(dimethylamino)-3-oxoprop-1-enyl]phenyl]ethoxycarbonylamino]ethyl]boronic acid |
| SMILES | CC(OC(=O)NC(Cc1coc2ccccc12)B(O)O)c1cccc(C=C(C#N)C(=O)N(C)C)c1 |
| InChI | InChI=1S/C25H26BN3O6/c1-16(18-8-6-7-17(11-18)12-19(14-27)24(30)29(2)3)35-25(31)28-23(26(32)33)13-20-15-34-22-10-5-4-9-21(20)22/h4-12,15-16,23,32-33H,13H2,1-3H3,(H,28,31) |
| InChIKey | NNBSPAQTVJSVAM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 136.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|