C22H25BN2O5 — CID 140861791
[(1R)-2-(1-benzofuran-3-yl)-1-[[(2S)-2-[2-(dimethylcarbamoyl)phenyl]propanoyl]amino]ethyl]boronic acid (PubChem CID 140861791) has the molecular formula C22H25BN2O5 and a molecular weight of 408.26 g/mol. Its IUPAC name is [(1R)-2-(1-benzofuran-3-yl)-1-[[(2S)-2-[2-(dimethylcarbamoyl)phenyl]propanoyl]amino]ethyl]boronic acid.
| Compound Name | [(1R)-2-(1-benzofuran-3-yl)-1-[[(2S)-2-[2-(dimethylcarbamoyl)phenyl]propanoyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 140861791 |
| Molecular Formula | C22H25BN2O5 |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | [(1R)-2-(1-benzofuran-3-yl)-1-[[(2S)-2-[2-(dimethylcarbamoyl)phenyl]propanoyl]amino]ethyl]boronic acid |
| SMILES | C[C@H](C(=O)N[C@@H](Cc1coc2ccccc12)B(O)O)c1ccccc1C(=O)N(C)C |
| InChI | InChI=1S/C22H25BN2O5/c1-14(16-8-4-5-10-18(16)22(27)25(2)3)21(26)24-20(23(28)29)12-15-13-30-19-11-7-6-9-17(15)19/h4-11,13-14,20,28-29H,12H2,1-3H3,(H,24,26)/t14-,20-/m0/s1 |
| InChIKey | LLESFGXCJUNAGH-XOBRGWDASA-N |
| XLogP | 1.98 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|