C21H23BN2O6 — CID 142771847
[(1R)-2-(1-benzofuran-3-yl)-1-[[2-[2-(dimethylcarbamoyl)phenyl]acetyl]amino]ethoxy]boronic acid (PubChem CID 142771847) has the molecular formula C21H23BN2O6 and a molecular weight of 410.24 g/mol. Its IUPAC name is [(1R)-2-(1-benzofuran-3-yl)-1-[[2-[2-(dimethylcarbamoyl)phenyl]acetyl]amino]ethoxy]boronic acid.
| Compound Name | [(1R)-2-(1-benzofuran-3-yl)-1-[[2-[2-(dimethylcarbamoyl)phenyl]acetyl]amino]ethoxy]boronic acid |
|---|---|
| PubChem CID | 142771847 |
| Molecular Formula | C21H23BN2O6 |
| Molecular Weight | 410.24 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [(1R)-2-(1-benzofuran-3-yl)-1-[[2-[2-(dimethylcarbamoyl)phenyl]acetyl]amino]ethoxy]boronic acid |
| SMILES | CN(C)C(=O)c1ccccc1CC(=O)N[C@@H](Cc1coc2ccccc12)OB(O)O |
| InChI | InChI=1S/C21H23BN2O6/c1-24(2)21(26)17-9-4-3-7-14(17)11-19(25)23-20(30-22(27)28)12-15-13-29-18-10-6-5-8-16(15)18/h3-10,13,20,27-28H,11-12H2,1-2H3,(H,23,25)/t20-/m1/s1 |
| InChIKey | QEDFHNQPECHDHL-HXUWFJFHSA-N |
| XLogP | 1.35 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|