C23H26BN3O5 — CID 174105994
[1-[[2-[[3-[2-cyano-3-(dimethylamino)-3-oxoprop-1-enyl]phenyl]methoxy]acetyl]amino]-2-phenylethyl]boronic acid (PubChem CID 174105994) has the molecular formula C23H26BN3O5 and a molecular weight of 435.29 g/mol. Its IUPAC name is [1-[[2-[[3-[2-cyano-3-(dimethylamino)-3-oxoprop-1-enyl]phenyl]methoxy]acetyl]amino]-2-phenylethyl]boronic acid.
| Compound Name | [1-[[2-[[3-[2-cyano-3-(dimethylamino)-3-oxoprop-1-enyl]phenyl]methoxy]acetyl]amino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 174105994 |
| Molecular Formula | C23H26BN3O5 |
| Molecular Weight | 435.29 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | [1-[[2-[[3-[2-cyano-3-(dimethylamino)-3-oxoprop-1-enyl]phenyl]methoxy]acetyl]amino]-2-phenylethyl]boronic acid |
| SMILES | CN(C)C(=O)C(C#N)=Cc1cccc(COCC(=O)NC(Cc2ccccc2)B(O)O)c1 |
| InChI | InChI=1S/C23H26BN3O5/c1-27(2)23(29)20(14-25)12-18-9-6-10-19(11-18)15-32-16-22(28)26-21(24(30)31)13-17-7-4-3-5-8-17/h3-12,21,30-31H,13,15-16H2,1-2H3,(H,26,28) |
| InChIKey | UOOKPGNBHRGTCU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|