C18H16N2O — CID 132546388
(E)-2-cyano-N,N-dimethyl-3-(4-phenylphenyl)prop-2-enamide (PubChem CID 132546388) has the molecular formula C18H16N2O and a molecular weight of 276.34 g/mol. Its IUPAC name is (E)-2-cyano-N,N-dimethyl-3-(4-phenylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N,N-dimethyl-3-(4-phenylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 132546388 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (E)-2-cyano-N,N-dimethyl-3-(4-phenylphenyl)prop-2-enamide |
| SMILES | CN(C)C(=O)/C(C#N)=C/c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H16N2O/c1-20(2)18(21)17(13-19)12-14-8-10-16(11-9-14)15-6-4-3-5-7-15/h3-12H,1-2H3/b17-12+ |
| InChIKey | WQMAKGXYPIUDDG-SFQUDFHCSA-N |
| XLogP | 3.35 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|