C31H21N3O2 — CID 177497739
(Z)-2-cyano-3-[4-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]phenyl]prop-2-enoic acid (PubChem CID 177497739) has the molecular formula C31H21N3O2 and a molecular weight of 467.53 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]phenyl]prop-2-enoic acid.
| Compound Name | (Z)-2-cyano-3-[4-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 177497739 |
| Molecular Formula | C31H21N3O2 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | (Z)-2-cyano-3-[4-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]phenyl]prop-2-enoic acid |
| SMILES | N#C/C(=C/c1ccc(-c2ccc(-c3nc(-c4ccccc4)c(-c4ccccc4)[nH]3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C31H21N3O2/c32-20-27(31(35)36)19-21-11-13-22(14-12-21)23-15-17-26(18-16-23)30-33-28(24-7-3-1-4-8-24)29(34-30)25-9-5-2-6-10-25/h1-19H,(H,33,34)(H,35,36)/b27-19- |
| InChIKey | SAQSICYVGUOMMD-DIBXZPPDSA-N |
| XLogP | 7.07 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|