C30H21N3 — CID 139205580
(Z)-3-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]-2-phenylprop-2-enenitrile (PubChem CID 139205580) has the molecular formula C30H21N3 and a molecular weight of 423.52 g/mol. Its IUPAC name is (Z)-3-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]-2-phenylprop-2-enenitrile.
| Compound Name | (Z)-3-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]-2-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 139205580 |
| Molecular Formula | C30H21N3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | (Z)-3-[4-(4,5-diphenyl-1H-imidazol-2-yl)phenyl]-2-phenylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H21N3/c31-21-27(23-10-4-1-5-11-23)20-22-16-18-26(19-17-22)30-32-28(24-12-6-2-7-13-24)29(33-30)25-14-8-3-9-15-25/h1-20H,(H,32,33)/b27-20+ |
| InChIKey | DNISPIOPLRBEBF-NHFJDJAPSA-N |
| XLogP | 7.47 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|