C22H15N3 — CID 139214742
2-(4,5-diphenyl-1H-imidazol-2-yl)benzonitrile (PubChem CID 139214742) has the molecular formula C22H15N3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-(4,5-diphenyl-1H-imidazol-2-yl)benzonitrile.
| Compound Name | 2-(4,5-diphenyl-1H-imidazol-2-yl)benzonitrile |
|---|---|
| PubChem CID | 139214742 |
| Molecular Formula | C22H15N3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 2-(4,5-diphenyl-1H-imidazol-2-yl)benzonitrile |
| SMILES | N#Cc1ccccc1-c1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C22H15N3/c23-15-18-13-7-8-14-19(18)22-24-20(16-9-3-1-4-10-16)21(25-22)17-11-5-2-6-12-17/h1-14H,(H,24,25) |
| InChIKey | QDIMFTZQDKIZFK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|