C30H22N2 — CID 177421589
2-[4-[2-(2-methylphenyl)ethynyl]phenyl]-4,5-diphenyl-1H-imidazole (PubChem CID 177421589) has the molecular formula C30H22N2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-[4-[2-(2-methylphenyl)ethynyl]phenyl]-4,5-diphenyl-1H-imidazole.
| Compound Name | 2-[4-[2-(2-methylphenyl)ethynyl]phenyl]-4,5-diphenyl-1H-imidazole |
|---|---|
| PubChem CID | 177421589 |
| Molecular Formula | C30H22N2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-[4-[2-(2-methylphenyl)ethynyl]phenyl]-4,5-diphenyl-1H-imidazole |
| SMILES | Cc1ccccc1C#Cc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C30H22N2/c1-22-10-8-9-11-24(22)19-16-23-17-20-27(21-18-23)30-31-28(25-12-4-2-5-13-25)29(32-30)26-14-6-3-7-15-26/h2-15,17-18,20-21H,1H3,(H,31,32) |
| InChIKey | GIXDYYSASMNPJB-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|