C26H20N2 — CID 139797871
2-(8-methylnaphthalen-2-yl)-4,5-diphenyl-1H-imidazole (PubChem CID 139797871) has the molecular formula C26H20N2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-(8-methylnaphthalen-2-yl)-4,5-diphenyl-1H-imidazole.
| Compound Name | 2-(8-methylnaphthalen-2-yl)-4,5-diphenyl-1H-imidazole |
|---|---|
| PubChem CID | 139797871 |
| Molecular Formula | C26H20N2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-(8-methylnaphthalen-2-yl)-4,5-diphenyl-1H-imidazole |
| SMILES | Cc1cccc2ccc(-c3nc(-c4ccccc4)c(-c4ccccc4)[nH]3)cc12 |
| InChI | InChI=1S/C26H20N2/c1-18-9-8-14-19-15-16-22(17-23(18)19)26-27-24(20-10-4-2-5-11-20)25(28-26)21-12-6-3-7-13-21/h2-17H,1H3,(H,27,28) |
| InChIKey | NRSKVVRQSBWZOD-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|