C26H21ClN2 — CID 146051305
2-(4-methylphenyl)-4-naphthalen-2-yl-5-phenyl-1H-imidazole;hydrochloride (PubChem CID 146051305) has the molecular formula C26H21ClN2 and a molecular weight of 396.92 g/mol. Its IUPAC name is 2-(4-methylphenyl)-4-naphthalen-2-yl-5-phenyl-1H-imidazole;hydrochloride.
| Compound Name | 2-(4-methylphenyl)-4-naphthalen-2-yl-5-phenyl-1H-imidazole;hydrochloride |
|---|---|
| PubChem CID | 146051305 |
| Molecular Formula | C26H21ClN2 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 2-(4-methylphenyl)-4-naphthalen-2-yl-5-phenyl-1H-imidazole;hydrochloride |
| SMILES | Cc1ccc(-c2nc(-c3ccc4ccccc4c3)c(-c3ccccc3)[nH]2)cc1.Cl |
| InChI | InChI=1S/C26H20N2.ClH/c1-18-11-13-21(14-12-18)26-27-24(20-8-3-2-4-9-20)25(28-26)23-16-15-19-7-5-6-10-22(19)17-23;/h2-17H,1H3,(H,27,28);1H |
| InChIKey | AMPMMXOJMNJCMG-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|