C67H48N4S — CID 59012346
2-[4-[6-[3-[4-[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]phenyl]-2-methyl-1-benzothiophen-6-yl]anthracen-2-yl]phenyl]-4,5-diphenyl-1H-imidazole (PubChem CID 59012346) has the molecular formula C67H48N4S and a molecular weight of 941.22 g/mol. Its IUPAC name is 2-[4-[6-[3-[4-[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]phenyl]-2-methyl-1-benzothiophen-6-yl]anthracen-2-yl]phenyl]-4,5-diphenyl-1H-imidazole.
| Compound Name | 2-[4-[6-[3-[4-[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]phenyl]-2-methyl-1-benzothiophen-6-yl]anthracen-2-yl]phenyl]-4,5-diphenyl-1H-imidazole |
|---|---|
| PubChem CID | 59012346 |
| Molecular Formula | C67H48N4S |
| Molecular Weight | 941.22 g/mol |
| Exact Mass | 940.36 |
| IUPAC Name | 2-[4-[6-[3-[4-[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]phenyl]-2-methyl-1-benzothiophen-6-yl]anthracen-2-yl]phenyl]-4,5-diphenyl-1H-imidazole |
| SMILES | Cc1ccc(-c2nc(-c3ccc(-c4c(C)sc5cc(-c6ccc7cc8cc(-c9ccc(-c%10nc(-c%11ccccc%11)c(-c%11ccccc%11)[nH]%10)cc9)ccc8cc7c6)ccc45)cc3)[nH]c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C67H48N4S/c1-41-14-18-48(19-15-41)64-65(49-20-16-42(2)17-21-49)71-67(70-64)51-28-24-45(25-29-51)61-43(3)72-60-40-56(34-35-59(60)61)53-31-33-55-38-57-36-52(30-32-54(57)39-58(55)37-53)44-22-26-50(27-23-44)66-68-62(46-10-6-4-7-11-46)63(69-66)47-12-8-5-9-13-47/h4-40H,1-3H3,(H,68,69)(H,70,71) |
| InChIKey | WHTJYFFLSYZASQ-UHFFFAOYSA-N |
| XLogP | 18.58 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.22 |
| LogP ≤ 5 | 18.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|