C35H22N2S — CID 4128398
4-dibenzothiophen-3-yl-5-phenyl-2-[4-(2-phenylethynyl)phenyl]-1H-imidazole (PubChem CID 4128398) has the molecular formula C35H22N2S and a molecular weight of 502.64 g/mol. Its IUPAC name is 4-dibenzothiophen-3-yl-5-phenyl-2-[4-(2-phenylethynyl)phenyl]-1H-imidazole.
| Compound Name | 4-dibenzothiophen-3-yl-5-phenyl-2-[4-(2-phenylethynyl)phenyl]-1H-imidazole |
|---|---|
| PubChem CID | 4128398 |
| Molecular Formula | C35H22N2S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 4-dibenzothiophen-3-yl-5-phenyl-2-[4-(2-phenylethynyl)phenyl]-1H-imidazole |
| SMILES | C(#Cc1ccc(-c2nc(-c3ccc4c(c3)sc3ccccc34)c(-c3ccccc3)[nH]2)cc1)c1ccccc1 |
| InChI | InChI=1S/C35H22N2S/c1-3-9-24(10-4-1)15-16-25-17-19-27(20-18-25)35-36-33(26-11-5-2-6-12-26)34(37-35)28-21-22-30-29-13-7-8-14-31(29)38-32(30)23-28/h1-14,17-23H,(H,36,37) |
| InChIKey | RUXUKPATMHFKQY-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|