C39H23N3S2 — CID 138613779
2,4-di(dibenzothiophen-3-yl)-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 138613779) has the molecular formula C39H23N3S2 and a molecular weight of 597.77 g/mol. Its IUPAC name is 2,4-di(dibenzothiophen-3-yl)-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2,4-di(dibenzothiophen-3-yl)-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 138613779 |
| Molecular Formula | C39H23N3S2 |
| Molecular Weight | 597.77 g/mol |
| Exact Mass | 597.13 |
| IUPAC Name | 2,4-di(dibenzothiophen-3-yl)-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(-c3nc(-c4ccc5c(c4)sc4ccccc45)nc(-c4ccc5c(c4)sc4ccccc45)n3)c2)cc1 |
| InChI | InChI=1S/C39H23N3S2/c1-2-9-24(10-3-1)25-11-8-12-26(21-25)37-40-38(27-17-19-31-29-13-4-6-15-33(29)43-35(31)22-27)42-39(41-37)28-18-20-32-30-14-5-7-16-34(30)44-36(32)23-28/h1-23H |
| InChIKey | GPQVUABSJABIIO-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.77 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |