C46H28N2S2 — CID 138613712
4,6-di(dibenzothiophen-3-yl)-2-[3-(4-phenylphenyl)phenyl]pyrimidine (PubChem CID 138613712) has the molecular formula C46H28N2S2 and a molecular weight of 672.88 g/mol. Its IUPAC name is 4,6-di(dibenzothiophen-3-yl)-2-[3-(4-phenylphenyl)phenyl]pyrimidine.
| Compound Name | 4,6-di(dibenzothiophen-3-yl)-2-[3-(4-phenylphenyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 138613712 |
| Molecular Formula | C46H28N2S2 |
| Molecular Weight | 672.88 g/mol |
| Exact Mass | 672.17 |
| IUPAC Name | 4,6-di(dibenzothiophen-3-yl)-2-[3-(4-phenylphenyl)phenyl]pyrimidine |
| SMILES | c1ccc(-c2ccc(-c3cccc(-c4nc(-c5ccc6c(c5)sc5ccccc56)cc(-c5ccc6c(c5)sc5ccccc56)n4)c3)cc2)cc1 |
| InChI | InChI=1S/C46H28N2S2/c1-2-9-29(10-3-1)30-17-19-31(20-18-30)32-11-8-12-35(25-32)46-47-40(33-21-23-38-36-13-4-6-15-42(36)49-44(38)26-33)28-41(48-46)34-22-24-39-37-14-5-7-16-43(37)50-45(39)27-34/h1-28H |
| InChIKey | DZVMGWUYNUEWKQ-UHFFFAOYSA-N |
| XLogP | 13.55 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.88 |
| LogP ≤ 5 | 13.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |