C46H30N2S — CID 171584552
4-(3-dibenzothiophen-3-yl-5-phenylphenyl)-2-phenyl-6-(3-phenylphenyl)pyrimidine (PubChem CID 171584552) has the molecular formula C46H30N2S and a molecular weight of 642.83 g/mol. Its IUPAC name is 4-(3-dibenzothiophen-3-yl-5-phenylphenyl)-2-phenyl-6-(3-phenylphenyl)pyrimidine.
| Compound Name | 4-(3-dibenzothiophen-3-yl-5-phenylphenyl)-2-phenyl-6-(3-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 171584552 |
| Molecular Formula | C46H30N2S |
| Molecular Weight | 642.83 g/mol |
| Exact Mass | 642.21 |
| IUPAC Name | 4-(3-dibenzothiophen-3-yl-5-phenylphenyl)-2-phenyl-6-(3-phenylphenyl)pyrimidine |
| SMILES | c1ccc(-c2cccc(-c3cc(-c4cc(-c5ccccc5)cc(-c5ccc6c(c5)sc5ccccc56)c4)nc(-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C46H30N2S/c1-4-13-31(14-5-1)34-19-12-20-36(25-34)42-30-43(48-46(47-42)33-17-8-3-9-18-33)39-27-37(32-15-6-2-7-16-32)26-38(28-39)35-23-24-41-40-21-10-11-22-44(40)49-45(41)29-35/h1-30H |
| InChIKey | FWABDYJMXXKVNB-UHFFFAOYSA-N |
| XLogP | 12.85 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.83 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |