C52H34N2S — CID 171584456
4-[3-dibenzothiophen-3-yl-5-(3-phenylphenyl)phenyl]-6-phenyl-2-(2-phenylphenyl)pyrimidine (PubChem CID 171584456) has the molecular formula C52H34N2S and a molecular weight of 718.93 g/mol. Its IUPAC name is 4-[3-dibenzothiophen-3-yl-5-(3-phenylphenyl)phenyl]-6-phenyl-2-(2-phenylphenyl)pyrimidine.
| Compound Name | 4-[3-dibenzothiophen-3-yl-5-(3-phenylphenyl)phenyl]-6-phenyl-2-(2-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 171584456 |
| Molecular Formula | C52H34N2S |
| Molecular Weight | 718.93 g/mol |
| Exact Mass | 718.24 |
| IUPAC Name | 4-[3-dibenzothiophen-3-yl-5-(3-phenylphenyl)phenyl]-6-phenyl-2-(2-phenylphenyl)pyrimidine |
| SMILES | c1ccc(-c2cccc(-c3cc(-c4ccc5c(c4)sc4ccccc45)cc(-c4cc(-c5ccccc5)nc(-c5ccccc5-c5ccccc5)n4)c3)c2)cc1 |
| InChI | InChI=1S/C52H34N2S/c1-4-15-35(16-5-1)38-21-14-22-39(29-38)41-30-42(40-27-28-46-45-24-12-13-26-50(45)55-51(46)33-40)32-43(31-41)49-34-48(37-19-8-3-9-20-37)53-52(54-49)47-25-11-10-23-44(47)36-17-6-2-7-18-36/h1-34H |
| InChIKey | ZVTXXTYQVODEBK-UHFFFAOYSA-N |
| XLogP | 14.51 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.93 |
| LogP ≤ 5 | 14.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |