C60H38N4S — CID 118640887
2-[7-[6-(3,5-diphenylphenyl)-2-phenylpyrimidin-4-yl]dibenzothiophen-3-yl]-4-(3-phenylphenyl)quinazoline (PubChem CID 118640887) has the molecular formula C60H38N4S and a molecular weight of 847.06 g/mol. Its IUPAC name is 2-[7-[6-(3,5-diphenylphenyl)-2-phenylpyrimidin-4-yl]dibenzothiophen-3-yl]-4-(3-phenylphenyl)quinazoline.
| Compound Name | 2-[7-[6-(3,5-diphenylphenyl)-2-phenylpyrimidin-4-yl]dibenzothiophen-3-yl]-4-(3-phenylphenyl)quinazoline |
|---|---|
| PubChem CID | 118640887 |
| Molecular Formula | C60H38N4S |
| Molecular Weight | 847.06 g/mol |
| Exact Mass | 846.28 |
| IUPAC Name | 2-[7-[6-(3,5-diphenylphenyl)-2-phenylpyrimidin-4-yl]dibenzothiophen-3-yl]-4-(3-phenylphenyl)quinazoline |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3cc(-c4ccc5c(c4)sc4cc(-c6nc(-c7cccc(-c8ccccc8)c7)c7ccccc7n6)ccc45)nc(-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C60H38N4S/c1-5-16-39(17-6-1)43-24-15-25-45(32-43)58-52-26-13-14-27-53(52)61-60(64-58)46-29-31-51-50-30-28-44(36-56(50)65-57(51)37-46)54-38-55(63-59(62-54)42-22-11-4-12-23-42)49-34-47(40-18-7-2-8-19-40)33-48(35-49)41-20-9-3-10-21-41/h1-38H |
| InChIKey | PZGXFNMURBXCRK-UHFFFAOYSA-N |
| XLogP | 16.12 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.06 |
| LogP ≤ 5 | 16.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |