C44H30N2 — CID 126579137
4-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]-2-phenylquinazoline (PubChem CID 126579137) has the molecular formula C44H30N2 and a molecular weight of 586.74 g/mol. Its IUPAC name is 4-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]-2-phenylquinazoline.
| Compound Name | 4-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]-2-phenylquinazoline |
|---|---|
| PubChem CID | 126579137 |
| Molecular Formula | C44H30N2 |
| Molecular Weight | 586.74 g/mol |
| Exact Mass | 586.24 |
| IUPAC Name | 4-[3-[3-(3,5-diphenylphenyl)phenyl]phenyl]-2-phenylquinazoline |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3cccc(-c4cccc(-c5nc(-c6ccccc6)nc6ccccc56)c4)c3)c2)cc1 |
| InChI | InChI=1S/C44H30N2/c1-4-14-31(15-5-1)38-28-39(32-16-6-2-7-17-32)30-40(29-38)36-22-12-20-34(26-36)35-21-13-23-37(27-35)43-41-24-10-11-25-42(41)45-44(46-43)33-18-8-3-9-19-33/h1-30H |
| InChIKey | CQWRWDINCIVMKC-UHFFFAOYSA-N |
| XLogP | 11.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.74 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |