C37H23N3S — CID 156673310
2-dibenzothiophen-3-yl-4-phenyl-6-(6-phenylnaphthalen-2-yl)-1,3,5-triazine (PubChem CID 156673310) has the molecular formula C37H23N3S and a molecular weight of 541.68 g/mol. Its IUPAC name is 2-dibenzothiophen-3-yl-4-phenyl-6-(6-phenylnaphthalen-2-yl)-1,3,5-triazine.
| Compound Name | 2-dibenzothiophen-3-yl-4-phenyl-6-(6-phenylnaphthalen-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 156673310 |
| Molecular Formula | C37H23N3S |
| Molecular Weight | 541.68 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | 2-dibenzothiophen-3-yl-4-phenyl-6-(6-phenylnaphthalen-2-yl)-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc3cc(-c4nc(-c5ccccc5)nc(-c5ccc6c(c5)sc5ccccc56)n4)ccc3c2)cc1 |
| InChI | InChI=1S/C37H23N3S/c1-3-9-24(10-4-1)26-15-16-28-22-29(18-17-27(28)21-26)36-38-35(25-11-5-2-6-12-25)39-37(40-36)30-19-20-32-31-13-7-8-14-33(31)41-34(32)23-30/h1-23H |
| InChIKey | BOFBYTPUOGMDTK-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.68 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |