C27H18N2S — CID 3913842
4-dibenzothiophen-3-yl-2,5-diphenyl-1H-imidazole (PubChem CID 3913842) has the molecular formula C27H18N2S and a molecular weight of 402.52 g/mol. Its IUPAC name is 4-dibenzothiophen-3-yl-2,5-diphenyl-1H-imidazole.
| Compound Name | 4-dibenzothiophen-3-yl-2,5-diphenyl-1H-imidazole |
|---|---|
| PubChem CID | 3913842 |
| Molecular Formula | C27H18N2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 4-dibenzothiophen-3-yl-2,5-diphenyl-1H-imidazole |
| SMILES | c1ccc(-c2nc(-c3ccc4c(c3)sc3ccccc34)c(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C27H18N2S/c1-3-9-18(10-4-1)25-26(29-27(28-25)19-11-5-2-6-12-19)20-15-16-22-21-13-7-8-14-23(21)30-24(22)17-20/h1-17H,(H,28,29) |
| InChIKey | PPRGNHYFGMSRIY-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|