C45H34N4O — CID 135438613
[4-[2-(4-methylphenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-[4-[2-(4-methylphenyl)-5-phenyl-1H-imidazol-4-yl]phenyl]methanone (PubChem CID 135438613) has the molecular formula C45H34N4O and a molecular weight of 646.79 g/mol. Its IUPAC name is [4-[2-(4-methylphenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-[4-[2-(4-methylphenyl)-5-phenyl-1H-imidazol-4-yl]phenyl]methanone.
| Compound Name | [4-[2-(4-methylphenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-[4-[2-(4-methylphenyl)-5-phenyl-1H-imidazol-4-yl]phenyl]methanone |
|---|---|
| PubChem CID | 135438613 |
| Molecular Formula | C45H34N4O |
| Molecular Weight | 646.79 g/mol |
| Exact Mass | 646.27 |
| IUPAC Name | [4-[2-(4-methylphenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-[4-[2-(4-methylphenyl)-5-phenyl-1H-imidazol-4-yl]phenyl]methanone |
| SMILES | Cc1ccc(-c2nc(-c3ccc(C(=O)c4ccc(-c5[nH]c(-c6ccc(C)cc6)nc5-c5ccccc5)cc4)cc3)c(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C45H34N4O/c1-29-13-17-37(18-14-29)44-46-39(31-9-5-3-6-10-31)41(48-44)33-21-25-35(26-22-33)43(50)36-27-23-34(24-28-36)42-40(32-11-7-4-8-12-32)47-45(49-42)38-19-15-30(2)16-20-38/h3-28H,1-2H3,(H,46,48)(H,47,49) |
| InChIKey | KLXINUMMZALTLD-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.79 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|