C31H26N2O4 — CID 2208629
phenyl-[4-[4-phenyl-2-(2,4,5-trimethoxyphenyl)-1H-imidazol-5-yl]phenyl]methanone (PubChem CID 2208629) has the molecular formula C31H26N2O4 and a molecular weight of 490.56 g/mol. Its IUPAC name is phenyl-[4-[4-phenyl-2-(2,4,5-trimethoxyphenyl)-1H-imidazol-5-yl]phenyl]methanone.
| Compound Name | phenyl-[4-[4-phenyl-2-(2,4,5-trimethoxyphenyl)-1H-imidazol-5-yl]phenyl]methanone |
|---|---|
| PubChem CID | 2208629 |
| Molecular Formula | C31H26N2O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | phenyl-[4-[4-phenyl-2-(2,4,5-trimethoxyphenyl)-1H-imidazol-5-yl]phenyl]methanone |
| SMILES | COc1cc(OC)c(-c2nc(-c3ccccc3)c(-c3ccc(C(=O)c4ccccc4)cc3)[nH]2)cc1OC |
| InChI | InChI=1S/C31H26N2O4/c1-35-25-19-27(37-3)26(36-2)18-24(25)31-32-28(20-10-6-4-7-11-20)29(33-31)21-14-16-23(17-15-21)30(34)22-12-8-5-9-13-22/h4-19H,1-3H3,(H,32,33) |
| InChIKey | SKKXCSVAXPFVKU-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|