C38H30N4O2 — CID 118411404
2-[2-(4,5-diphenyl-1H-imidazol-2-yl)-4,5-dimethoxyphenyl]-4,5-diphenyl-1H-imidazole (PubChem CID 118411404) has the molecular formula C38H30N4O2 and a molecular weight of 574.68 g/mol. Its IUPAC name is 2-[2-(4,5-diphenyl-1H-imidazol-2-yl)-4,5-dimethoxyphenyl]-4,5-diphenyl-1H-imidazole.
| Compound Name | 2-[2-(4,5-diphenyl-1H-imidazol-2-yl)-4,5-dimethoxyphenyl]-4,5-diphenyl-1H-imidazole |
|---|---|
| PubChem CID | 118411404 |
| Molecular Formula | C38H30N4O2 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | 2-[2-(4,5-diphenyl-1H-imidazol-2-yl)-4,5-dimethoxyphenyl]-4,5-diphenyl-1H-imidazole |
| SMILES | COc1cc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)c(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1OC |
| InChI | InChI=1S/C38H30N4O2/c1-43-31-23-29(37-39-33(25-15-7-3-8-16-25)34(40-37)26-17-9-4-10-18-26)30(24-32(31)44-2)38-41-35(27-19-11-5-12-20-27)36(42-38)28-21-13-6-14-22-28/h3-24H,1-2H3,(H,39,40)(H,41,42) |
| InChIKey | MYJHHYFLFUYOGL-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|