C45H36N4O2 — CID 71231270
2-[2-[3-[2-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]propoxy]phenyl]-4,5-diphenyl-1H-imidazole (PubChem CID 71231270) has the molecular formula C45H36N4O2 and a molecular weight of 664.81 g/mol. Its IUPAC name is 2-[2-[3-[2-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]propoxy]phenyl]-4,5-diphenyl-1H-imidazole.
| Compound Name | 2-[2-[3-[2-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]propoxy]phenyl]-4,5-diphenyl-1H-imidazole |
|---|---|
| PubChem CID | 71231270 |
| Molecular Formula | C45H36N4O2 |
| Molecular Weight | 664.81 g/mol |
| Exact Mass | 664.28 |
| IUPAC Name | 2-[2-[3-[2-(4,5-diphenyl-1H-imidazol-2-yl)phenoxy]propoxy]phenyl]-4,5-diphenyl-1H-imidazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3OCCCOc3ccccc3-c3nc(-c4ccccc4)c(-c4ccccc4)[nH]3)[nH]c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C45H36N4O2/c1-5-18-32(19-6-1)40-41(33-20-7-2-8-21-33)47-44(46-40)36-26-13-15-28-38(36)50-30-17-31-51-39-29-16-14-27-37(39)45-48-42(34-22-9-3-10-23-34)43(49-45)35-24-11-4-12-25-35/h1-16,18-29H,17,30-31H2,(H,46,47)(H,48,49) |
| InChIKey | NDWLDGRUYJKJTJ-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.81 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|