C29H32N2O — CID 4148530
2-(4-octoxyphenyl)-4,5-diphenyl-1H-imidazole (PubChem CID 4148530) has the molecular formula C29H32N2O and a molecular weight of 424.59 g/mol. Its IUPAC name is 2-(4-octoxyphenyl)-4,5-diphenyl-1H-imidazole.
| Compound Name | 2-(4-octoxyphenyl)-4,5-diphenyl-1H-imidazole |
|---|---|
| PubChem CID | 4148530 |
| Molecular Formula | C29H32N2O |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 2-(4-octoxyphenyl)-4,5-diphenyl-1H-imidazole |
| SMILES | CCCCCCCCOc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C29H32N2O/c1-2-3-4-5-6-13-22-32-26-20-18-25(19-21-26)29-30-27(23-14-9-7-10-15-23)28(31-29)24-16-11-8-12-17-24/h7-12,14-21H,2-6,13,22H2,1H3,(H,30,31) |
| InChIKey | LOZQORUJFOFLEZ-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|