C25H30N2O2 — CID 54186770
octyl 2-(4,5-diphenyl-1H-imidazol-2-yl)acetate (PubChem CID 54186770) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is octyl 2-(4,5-diphenyl-1H-imidazol-2-yl)acetate.
| Compound Name | octyl 2-(4,5-diphenyl-1H-imidazol-2-yl)acetate |
|---|---|
| PubChem CID | 54186770 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | octyl 2-(4,5-diphenyl-1H-imidazol-2-yl)acetate |
| SMILES | CCCCCCCCOC(=O)Cc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C25H30N2O2/c1-2-3-4-5-6-13-18-29-23(28)19-22-26-24(20-14-9-7-10-15-20)25(27-22)21-16-11-8-12-17-21/h7-12,14-17H,2-6,13,18-19H2,1H3,(H,26,27) |
| InChIKey | PFQAZBRKYIINDS-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|