C23H28N2O2 — CID 57426288
2-hexyl-4,5-bis(4-methoxyphenyl)-1H-imidazole (PubChem CID 57426288) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-hexyl-4,5-bis(4-methoxyphenyl)-1H-imidazole.
| Compound Name | 2-hexyl-4,5-bis(4-methoxyphenyl)-1H-imidazole |
|---|---|
| PubChem CID | 57426288 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 2-hexyl-4,5-bis(4-methoxyphenyl)-1H-imidazole |
| SMILES | CCCCCCc1nc(-c2ccc(OC)cc2)c(-c2ccc(OC)cc2)[nH]1 |
| InChI | InChI=1S/C23H28N2O2/c1-4-5-6-7-8-21-24-22(17-9-13-19(26-2)14-10-17)23(25-21)18-11-15-20(27-3)16-12-18/h9-16H,4-8H2,1-3H3,(H,24,25) |
| InChIKey | GUMFQJXMUNOZEP-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|