C24H30N2O2 — CID 91394090
2-[5-(3-methoxypropoxy)pentyl]-4,5-diphenyl-1H-imidazole (PubChem CID 91394090) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-[5-(3-methoxypropoxy)pentyl]-4,5-diphenyl-1H-imidazole.
| Compound Name | 2-[5-(3-methoxypropoxy)pentyl]-4,5-diphenyl-1H-imidazole |
|---|---|
| PubChem CID | 91394090 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 2-[5-(3-methoxypropoxy)pentyl]-4,5-diphenyl-1H-imidazole |
| SMILES | COCCCOCCCCCc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C24H30N2O2/c1-27-17-11-19-28-18-10-4-9-16-22-25-23(20-12-5-2-6-13-20)24(26-22)21-14-7-3-8-15-21/h2-3,5-8,12-15H,4,9-11,16-19H2,1H3,(H,25,26) |
| InChIKey | DRVABHWGOLRQOG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|