About 2-[4-(3-ethoxypropoxy)butyl]-4,5-diphenyl-1H-imidazole
2-[4-(3-ethoxypropoxy)butyl]-4,5-diphenyl-1H-imidazole (PubChem CID 90967787) has the molecular formula C24H30N2O2
and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-[4-(3-ethoxypropoxy)butyl]-4,5-diphenyl-1H-imidazole.
Molecular Properties
| Compound Name | 2-[4-(3-ethoxypropoxy)butyl]-4,5-diphenyl-1H-imidazole |
| PubChem CID | 90967787 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 2-[4-(3-ethoxypropoxy)butyl]-4,5-diphenyl-1H-imidazole |
| SMILES | CCOCCCOCCCCc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C24H30N2O2/c1-2-27-18-11-19-28-17-10-9-16-22-25-23(20-12-5-3-6-13-20)24(26-22)21-14-7-4-8-15-21/h3-8,12-15H,2,9-11,16-19H2,1H3,(H,25,26) |
| InChIKey | XJTXKWBVBXHACJ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(3-ethoxypropoxy)butyl]-4,5-diphenyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3-ethoxypropoxy)butyl]-4,5-diphenyl-1H-imidazole?
The IUPAC name of 2-[4-(3-ethoxypropoxy)butyl]-4,5-diphenyl-1H-imidazole (CID 90967787) is 2-[4-(3-ethoxypropoxy)butyl]-4,5-diphenyl-1H-imidazole.
What is the SMILES notation for 2-[4-(3-ethoxypropoxy)butyl]-4,5-diphenyl-1H-imidazole?
The canonical SMILES for 2-[4-(3-ethoxypropoxy)butyl]-4,5-diphenyl-1H-imidazole is CCOCCCOCCCCc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1.
What is the InChIKey of 2-[4-(3-ethoxypropoxy)butyl]-4,5-diphenyl-1H-imidazole?
The InChIKey is XJTXKWBVBXHACJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N2O2/c1-2-27-18-11-19-28-17-10-9-16-22-25-23(20-12-5-3-6-13-20)24(26-22)21-14-7-4-8-15-21/h3-8,12-15H,2,9-11,16-19H2,1H3,(H,25,26).
What are the key properties of 2-[4-(3-ethoxypropoxy)butyl]-4,5-diphenyl-1H-imidazole?
2-[4-(3-ethoxypropoxy)butyl]-4,5-diphenyl-1H-imidazole has a molecular weight of 378.52 g/mol, XLogP of 5.51, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3-ethoxypropoxy)butyl]-4,5-diphenyl-1H-imidazole is sourced from PubChem (CID 90967787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).