C21H24N2 — CID 139695615
5-methyl-4-phenyl-2-(5-phenylpentyl)-1H-imidazole (PubChem CID 139695615) has the molecular formula C21H24N2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 5-methyl-4-phenyl-2-(5-phenylpentyl)-1H-imidazole.
| Compound Name | 5-methyl-4-phenyl-2-(5-phenylpentyl)-1H-imidazole |
|---|---|
| PubChem CID | 139695615 |
| Molecular Formula | C21H24N2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 5-methyl-4-phenyl-2-(5-phenylpentyl)-1H-imidazole |
| SMILES | Cc1[nH]c(CCCCCc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C21H24N2/c1-17-21(19-14-8-4-9-15-19)23-20(22-17)16-10-3-7-13-18-11-5-2-6-12-18/h2,4-6,8-9,11-12,14-15H,3,7,10,13,16H2,1H3,(H,22,23) |
| InChIKey | ROGJRDOXVXJIQU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|