C22H24Cl2N2 — CID 139695554
4-[(3,4-dichlorophenyl)methyl]-5-methyl-2-(5-phenylpentyl)-1H-imidazole (PubChem CID 139695554) has the molecular formula C22H24Cl2N2 and a molecular weight of 387.35 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methyl]-5-methyl-2-(5-phenylpentyl)-1H-imidazole.
| Compound Name | 4-[(3,4-dichlorophenyl)methyl]-5-methyl-2-(5-phenylpentyl)-1H-imidazole |
|---|---|
| PubChem CID | 139695554 |
| Molecular Formula | C22H24Cl2N2 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methyl]-5-methyl-2-(5-phenylpentyl)-1H-imidazole |
| SMILES | Cc1[nH]c(CCCCCc2ccccc2)nc1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H24Cl2N2/c1-16-21(15-18-12-13-19(23)20(24)14-18)26-22(25-16)11-7-3-6-10-17-8-4-2-5-9-17/h2,4-5,8-9,12-14H,3,6-7,10-11,15H2,1H3,(H,25,26) |
| InChIKey | NQEXRIHUHYRZNW-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|