C20H26 — CID 123294821
1,2-dimethyl-4-(6-phenylhexyl)benzene (PubChem CID 123294821) has the molecular formula C20H26 and a molecular weight of 266.43 g/mol. Its IUPAC name is 1,2-dimethyl-4-(6-phenylhexyl)benzene.
| Compound Name | 1,2-dimethyl-4-(6-phenylhexyl)benzene |
|---|---|
| PubChem CID | 123294821 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 1,2-dimethyl-4-(6-phenylhexyl)benzene |
| SMILES | Cc1ccc(CCCCCCc2ccccc2)cc1C |
| InChI | InChI=1S/C20H26/c1-17-14-15-20(16-18(17)2)13-7-4-3-6-10-19-11-8-5-9-12-19/h5,8-9,11-12,14-16H,3-4,6-7,10,13H2,1-2H3 |
| InChIKey | ADLDSLVKJRSTNY-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|