C19H20N2O3 — CID 20556887
2-[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]ethanol (PubChem CID 20556887) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]ethanol.
| Compound Name | 2-[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]ethanol |
|---|---|
| PubChem CID | 20556887 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]ethanol |
| SMILES | COc1ccc(-c2nc(CCO)[nH]c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H20N2O3/c1-23-15-7-3-13(4-8-15)18-19(21-17(20-18)11-12-22)14-5-9-16(24-2)10-6-14/h3-10,22H,11-12H2,1-2H3,(H,20,21) |
| InChIKey | FCPLQACMWSPCRG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 67.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |