C45H34N4O3 — CID 135495721
[4-[2-(4-methoxyphenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-[4-[2-(4-methoxyphenyl)-5-phenyl-1H-imidazol-4-yl]phenyl]methanone (PubChem CID 135495721) has the molecular formula C45H34N4O3 and a molecular weight of 678.79 g/mol. Its IUPAC name is [4-[2-(4-methoxyphenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-[4-[2-(4-methoxyphenyl)-5-phenyl-1H-imidazol-4-yl]phenyl]methanone.
| Compound Name | [4-[2-(4-methoxyphenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-[4-[2-(4-methoxyphenyl)-5-phenyl-1H-imidazol-4-yl]phenyl]methanone |
|---|---|
| PubChem CID | 135495721 |
| Molecular Formula | C45H34N4O3 |
| Molecular Weight | 678.79 g/mol |
| Exact Mass | 678.26 |
| IUPAC Name | [4-[2-(4-methoxyphenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-[4-[2-(4-methoxyphenyl)-5-phenyl-1H-imidazol-4-yl]phenyl]methanone |
| SMILES | COc1ccc(-c2nc(-c3ccc(C(=O)c4ccc(-c5[nH]c(-c6ccc(OC)cc6)nc5-c5ccccc5)cc4)cc3)c(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C45H34N4O3/c1-51-37-25-21-35(22-26-37)44-46-39(29-9-5-3-6-10-29)41(48-44)31-13-17-33(18-14-31)43(50)34-19-15-32(16-20-34)42-40(30-11-7-4-8-12-30)47-45(49-42)36-23-27-38(52-2)28-24-36/h3-28H,1-2H3,(H,46,48)(H,47,49) |
| InChIKey | SESZUWRXTMLGKI-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.79 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|