C22H16N2O2 — CID 2538348
2-(4,5-diphenyl-1H-imidazol-2-yl)benzoic acid (PubChem CID 2538348) has the molecular formula C22H16N2O2 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-(4,5-diphenyl-1H-imidazol-2-yl)benzoic acid.
| Compound Name | 2-(4,5-diphenyl-1H-imidazol-2-yl)benzoic acid |
|---|---|
| PubChem CID | 2538348 |
| Molecular Formula | C22H16N2O2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-(4,5-diphenyl-1H-imidazol-2-yl)benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C22H16N2O2/c25-22(26)18-14-8-7-13-17(18)21-23-19(15-9-3-1-4-10-15)20(24-21)16-11-5-2-6-12-16/h1-14H,(H,23,24)(H,25,26) |
| InChIKey | UALPLQXZXWXMAM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|