C23H20N2O2 — CID 1036272
2-(2,4-dimethoxyphenyl)-4,5-diphenyl-1H-imidazole (PubChem CID 1036272) has the molecular formula C23H20N2O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-4,5-diphenyl-1H-imidazole.
| Compound Name | 2-(2,4-dimethoxyphenyl)-4,5-diphenyl-1H-imidazole |
|---|---|
| PubChem CID | 1036272 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-4,5-diphenyl-1H-imidazole |
| SMILES | COc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)c(OC)c1 |
| InChI | InChI=1S/C23H20N2O2/c1-26-18-13-14-19(20(15-18)27-2)23-24-21(16-9-5-3-6-10-16)22(25-23)17-11-7-4-8-12-17/h3-15H,1-2H3,(H,24,25) |
| InChIKey | CTWRMVAKUSJNBK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|