About 2-(2,4-dimethoxyphenyl)-4,5-diphenyl-1H-imidazole
2-(2,4-dimethoxyphenyl)-4,5-diphenyl-1H-imidazole (PubChem CID 1036272) has the molecular formula C23H20N2O2
and a molecular weight of 356.43 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-4,5-diphenyl-1H-imidazole.
Molecular Properties
| Compound Name | 2-(2,4-dimethoxyphenyl)-4,5-diphenyl-1H-imidazole |
| PubChem CID | 1036272 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-4,5-diphenyl-1H-imidazole |
| SMILES | COc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)c(OC)c1 |
| InChI | InChI=1S/C23H20N2O2/c1-26-18-13-14-19(20(15-18)27-2)23-24-21(16-9-5-3-6-10-16)22(25-23)17-11-7-4-8-12-17/h3-15H,1-2H3,(H,24,25) |
| InChIKey | CTWRMVAKUSJNBK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dimethoxyphenyl)-4,5-diphenyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethoxyphenyl)-4,5-diphenyl-1H-imidazole?
The IUPAC name of 2-(2,4-dimethoxyphenyl)-4,5-diphenyl-1H-imidazole (CID 1036272) is 2-(2,4-dimethoxyphenyl)-4,5-diphenyl-1H-imidazole.
What is the SMILES notation for 2-(2,4-dimethoxyphenyl)-4,5-diphenyl-1H-imidazole?
The canonical SMILES for 2-(2,4-dimethoxyphenyl)-4,5-diphenyl-1H-imidazole is COc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)c(OC)c1.
What is the InChIKey of 2-(2,4-dimethoxyphenyl)-4,5-diphenyl-1H-imidazole?
The InChIKey is CTWRMVAKUSJNBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N2O2/c1-26-18-13-14-19(20(15-18)27-2)23-24-21(16-9-5-3-6-10-16)22(25-23)17-11-7-4-8-12-17/h3-15H,1-2H3,(H,24,25).
What are the key properties of 2-(2,4-dimethoxyphenyl)-4,5-diphenyl-1H-imidazole?
2-(2,4-dimethoxyphenyl)-4,5-diphenyl-1H-imidazole has a molecular weight of 356.43 g/mol, XLogP of 5.43, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethoxyphenyl)-4,5-diphenyl-1H-imidazole is sourced from PubChem (CID 1036272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).