C46H39Cl3N4O — CID 162284056
2,5-bis(2-chlorophenyl)-4-(3-methoxy-4-methylphenyl)-1H-imidazole;2-(2-chlorophenyl)-4,5-diphenyl-1H-imidazole;ethane (PubChem CID 162284056) has the molecular formula C46H39Cl3N4O and a molecular weight of 770.20 g/mol. Its IUPAC name is 2,5-bis(2-chlorophenyl)-4-(3-methoxy-4-methylphenyl)-1H-imidazole;2-(2-chlorophenyl)-4,5-diphenyl-1H-imidazole;ethane.
| Compound Name | 2,5-bis(2-chlorophenyl)-4-(3-methoxy-4-methylphenyl)-1H-imidazole;2-(2-chlorophenyl)-4,5-diphenyl-1H-imidazole;ethane |
|---|---|
| PubChem CID | 162284056 |
| Molecular Formula | C46H39Cl3N4O |
| Molecular Weight | 770.20 g/mol |
| Exact Mass | 768.22 |
| IUPAC Name | 2,5-bis(2-chlorophenyl)-4-(3-methoxy-4-methylphenyl)-1H-imidazole;2-(2-chlorophenyl)-4,5-diphenyl-1H-imidazole;ethane |
| SMILES | CC.COc1cc(-c2nc(-c3ccccc3Cl)[nH]c2-c2ccccc2Cl)ccc1C.Clc1ccccc1-c1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C23H18Cl2N2O.C21H15ClN2.C2H6/c1-14-11-12-15(13-20(14)28-2)21-22(16-7-3-5-9-18(16)24)27-23(26-21)17-8-4-6-10-19(17)25;22-18-14-8-7-13-17(18)21-23-19(15-9-3-1-4-10-15)20(24-21)16-11-5-2-6-12-16;1-2/h3-13H,1-2H3,(H,26,27);1-14H,(H,23,24);1-2H3 |
| InChIKey | VUWMGXOZMQDEHG-UHFFFAOYSA-N |
| XLogP | 14.12 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.20 |
| LogP ≤ 5 | 14.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|