About 2-[2-(2,5-dichlorophenyl)phenyl]-4,5-diphenyl-1H-imidazole
2-[2-(2,5-dichlorophenyl)phenyl]-4,5-diphenyl-1H-imidazole (PubChem CID 58038056) has the molecular formula C27H18Cl2N2
and a molecular weight of 441.36 g/mol. Its IUPAC name is 2-[2-(2,5-dichlorophenyl)phenyl]-4,5-diphenyl-1H-imidazole.
Molecular Properties
| Compound Name | 2-[2-(2,5-dichlorophenyl)phenyl]-4,5-diphenyl-1H-imidazole |
| PubChem CID | 58038056 |
| Molecular Formula | C27H18Cl2N2 |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 2-[2-(2,5-dichlorophenyl)phenyl]-4,5-diphenyl-1H-imidazole |
| SMILES | Clc1ccc(Cl)c(-c2ccccc2-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)c1 |
| InChI | InChI=1S/C27H18Cl2N2/c28-20-15-16-24(29)23(17-20)21-13-7-8-14-22(21)27-30-25(18-9-3-1-4-10-18)26(31-27)19-11-5-2-6-12-19/h1-17H,(H,30,31) |
| InChIKey | OVGULUOJQQHYHN-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,5-dichlorophenyl)phenyl]-4,5-diphenyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,5-dichlorophenyl)phenyl]-4,5-diphenyl-1H-imidazole?
The IUPAC name of 2-[2-(2,5-dichlorophenyl)phenyl]-4,5-diphenyl-1H-imidazole (CID 58038056) is 2-[2-(2,5-dichlorophenyl)phenyl]-4,5-diphenyl-1H-imidazole.
What is the SMILES notation for 2-[2-(2,5-dichlorophenyl)phenyl]-4,5-diphenyl-1H-imidazole?
The canonical SMILES for 2-[2-(2,5-dichlorophenyl)phenyl]-4,5-diphenyl-1H-imidazole is Clc1ccc(Cl)c(-c2ccccc2-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)c1.
What is the InChIKey of 2-[2-(2,5-dichlorophenyl)phenyl]-4,5-diphenyl-1H-imidazole?
The InChIKey is OVGULUOJQQHYHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H18Cl2N2/c28-20-15-16-24(29)23(17-20)21-13-7-8-14-22(21)27-30-25(18-9-3-1-4-10-18)26(31-27)19-11-5-2-6-12-19/h1-17H,(H,30,31).
What are the key properties of 2-[2-(2,5-dichlorophenyl)phenyl]-4,5-diphenyl-1H-imidazole?
2-[2-(2,5-dichlorophenyl)phenyl]-4,5-diphenyl-1H-imidazole has a molecular weight of 441.36 g/mol, XLogP of 8.38, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,5-dichlorophenyl)phenyl]-4,5-diphenyl-1H-imidazole is sourced from PubChem (CID 58038056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).