C21H12Cl4N2 — CID 134119534
4,5-bis(4-chlorophenyl)-2-(3,4-dichlorophenyl)-1H-imidazole (PubChem CID 134119534) has the molecular formula C21H12Cl4N2 and a molecular weight of 434.15 g/mol. Its IUPAC name is 4,5-bis(4-chlorophenyl)-2-(3,4-dichlorophenyl)-1H-imidazole.
| Compound Name | 4,5-bis(4-chlorophenyl)-2-(3,4-dichlorophenyl)-1H-imidazole |
|---|---|
| PubChem CID | 134119534 |
| Molecular Formula | C21H12Cl4N2 |
| Molecular Weight | 434.15 g/mol |
| Exact Mass | 431.98 |
| IUPAC Name | 4,5-bis(4-chlorophenyl)-2-(3,4-dichlorophenyl)-1H-imidazole |
| SMILES | Clc1ccc(-c2nc(-c3ccc(Cl)c(Cl)c3)[nH]c2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H12Cl4N2/c22-15-6-1-12(2-7-15)19-20(13-3-8-16(23)9-4-13)27-21(26-19)14-5-10-17(24)18(25)11-14/h1-11H,(H,26,27) |
| InChIKey | BYBPVIBMHBTNRA-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.15 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|