C21H13Cl2N3O2 — CID 2832814
4,5-bis(4-chlorophenyl)-2-(4-nitrophenyl)-1H-imidazole (PubChem CID 2832814) has the molecular formula C21H13Cl2N3O2 and a molecular weight of 410.26 g/mol. Its IUPAC name is 4,5-bis(4-chlorophenyl)-2-(4-nitrophenyl)-1H-imidazole.
| Compound Name | 4,5-bis(4-chlorophenyl)-2-(4-nitrophenyl)-1H-imidazole |
|---|---|
| PubChem CID | 2832814 |
| Molecular Formula | C21H13Cl2N3O2 |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | 4,5-bis(4-chlorophenyl)-2-(4-nitrophenyl)-1H-imidazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nc(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3)[nH]2)cc1 |
| InChI | InChI=1S/C21H13Cl2N3O2/c22-16-7-1-13(2-8-16)19-20(14-3-9-17(23)10-4-14)25-21(24-19)15-5-11-18(12-6-15)26(27)28/h1-12H,(H,24,25) |
| InChIKey | KBXDOAOATJGDAA-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|