C27H21N7O2 — CID 102466776
4-[4-(4-aminophenyl)-2-[4-[(4-nitrophenyl)diazenyl]phenyl]-1H-imidazol-5-yl]aniline (PubChem CID 102466776) has the molecular formula C27H21N7O2 and a molecular weight of 475.51 g/mol. Its IUPAC name is 4-[4-(4-aminophenyl)-2-[4-[(4-nitrophenyl)diazenyl]phenyl]-1H-imidazol-5-yl]aniline.
| Compound Name | 4-[4-(4-aminophenyl)-2-[4-[(4-nitrophenyl)diazenyl]phenyl]-1H-imidazol-5-yl]aniline |
|---|---|
| PubChem CID | 102466776 |
| Molecular Formula | C27H21N7O2 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 4-[4-(4-aminophenyl)-2-[4-[(4-nitrophenyl)diazenyl]phenyl]-1H-imidazol-5-yl]aniline |
| SMILES | Nc1ccc(-c2nc(-c3ccc(/N=N/c4ccc([N+](=O)[O-])cc4)cc3)[nH]c2-c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C27H21N7O2/c28-20-7-1-17(2-8-20)25-26(18-3-9-21(29)10-4-18)31-27(30-25)19-5-11-22(12-6-19)32-33-23-13-15-24(16-14-23)34(35)36/h1-16H,28-29H2,(H,30,31)/b33-32+ |
| InChIKey | UDQYWSKCYSZLMG-ULIFNZDWSA-N |
| XLogP | 6.90 |
| TPSA | 148.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|