C36H24N6O4 — CID 135420019
4-(4-nitrophenyl)-2-[4-[4-(4-nitrophenyl)-5-phenyl-1H-imidazol-2-yl]phenyl]-5-phenyl-1H-imidazole (PubChem CID 135420019) has the molecular formula C36H24N6O4 and a molecular weight of 604.63 g/mol. Its IUPAC name is 4-(4-nitrophenyl)-2-[4-[4-(4-nitrophenyl)-5-phenyl-1H-imidazol-2-yl]phenyl]-5-phenyl-1H-imidazole.
| Compound Name | 4-(4-nitrophenyl)-2-[4-[4-(4-nitrophenyl)-5-phenyl-1H-imidazol-2-yl]phenyl]-5-phenyl-1H-imidazole |
|---|---|
| PubChem CID | 135420019 |
| Molecular Formula | C36H24N6O4 |
| Molecular Weight | 604.63 g/mol |
| Exact Mass | 604.19 |
| IUPAC Name | 4-(4-nitrophenyl)-2-[4-[4-(4-nitrophenyl)-5-phenyl-1H-imidazol-2-yl]phenyl]-5-phenyl-1H-imidazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nc(-c3ccc(-c4nc(-c5ccc([N+](=O)[O-])cc5)c(-c5ccccc5)[nH]4)cc3)[nH]c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C36H24N6O4/c43-41(44)29-19-15-25(16-20-29)33-31(23-7-3-1-4-8-23)37-35(39-33)27-11-13-28(14-12-27)36-38-32(24-9-5-2-6-10-24)34(40-36)26-17-21-30(22-18-26)42(45)46/h1-22H,(H,37,39)(H,38,40) |
| InChIKey | IHZAULOMKSKXSA-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 143.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.63 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|