C36H26N8O4 — CID 101105768
4-[4-(4-aminophenyl)-2-[4-[4,5-bis(4-nitrophenyl)-1H-imidazol-2-yl]phenyl]-1H-imidazol-5-yl]aniline (PubChem CID 101105768) has the molecular formula C36H26N8O4 and a molecular weight of 634.66 g/mol. Its IUPAC name is 4-[4-(4-aminophenyl)-2-[4-[4,5-bis(4-nitrophenyl)-1H-imidazol-2-yl]phenyl]-1H-imidazol-5-yl]aniline.
| Compound Name | 4-[4-(4-aminophenyl)-2-[4-[4,5-bis(4-nitrophenyl)-1H-imidazol-2-yl]phenyl]-1H-imidazol-5-yl]aniline |
|---|---|
| PubChem CID | 101105768 |
| Molecular Formula | C36H26N8O4 |
| Molecular Weight | 634.66 g/mol |
| Exact Mass | 634.21 |
| IUPAC Name | 4-[4-(4-aminophenyl)-2-[4-[4,5-bis(4-nitrophenyl)-1H-imidazol-2-yl]phenyl]-1H-imidazol-5-yl]aniline |
| SMILES | Nc1ccc(-c2nc(-c3ccc(-c4nc(-c5ccc([N+](=O)[O-])cc5)c(-c5ccc([N+](=O)[O-])cc5)[nH]4)cc3)[nH]c2-c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C36H26N8O4/c37-27-13-5-21(6-14-27)31-32(22-7-15-28(38)16-8-22)40-35(39-31)25-1-3-26(4-2-25)36-41-33(23-9-17-29(18-10-23)43(45)46)34(42-36)24-11-19-30(20-12-24)44(47)48/h1-20H,37-38H2,(H,39,40)(H,41,42) |
| InChIKey | BZDYCIVLOCYCQL-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 195.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.66 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|