C35H22ClN3O2 — CID 3568326
2-(10-chloroanthracen-9-yl)-5-[4-(4-nitrophenyl)phenyl]-4-phenyl-1H-imidazole (PubChem CID 3568326) has the molecular formula C35H22ClN3O2 and a molecular weight of 552.03 g/mol. Its IUPAC name is 2-(10-chloroanthracen-9-yl)-5-[4-(4-nitrophenyl)phenyl]-4-phenyl-1H-imidazole.
| Compound Name | 2-(10-chloroanthracen-9-yl)-5-[4-(4-nitrophenyl)phenyl]-4-phenyl-1H-imidazole |
|---|---|
| PubChem CID | 3568326 |
| Molecular Formula | C35H22ClN3O2 |
| Molecular Weight | 552.03 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | 2-(10-chloroanthracen-9-yl)-5-[4-(4-nitrophenyl)phenyl]-4-phenyl-1H-imidazole |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(-c3[nH]c(-c4c5ccccc5c(Cl)c5ccccc45)nc3-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C35H22ClN3O2/c36-32-29-12-6-4-10-27(29)31(28-11-5-7-13-30(28)32)35-37-33(24-8-2-1-3-9-24)34(38-35)25-16-14-22(15-17-25)23-18-20-26(21-19-23)39(40)41/h1-21H,(H,37,38) |
| InChIKey | WGNOLVFAOUAEST-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.03 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|