C24H18N4O2 — CID 71103102
5-methyl-3-[5-(4-nitrophenyl)-4-phenyl-1H-imidazol-2-yl]-1H-indole (PubChem CID 71103102) has the molecular formula C24H18N4O2 and a molecular weight of 394.43 g/mol. Its IUPAC name is 5-methyl-3-[5-(4-nitrophenyl)-4-phenyl-1H-imidazol-2-yl]-1H-indole.
| Compound Name | 5-methyl-3-[5-(4-nitrophenyl)-4-phenyl-1H-imidazol-2-yl]-1H-indole |
|---|---|
| PubChem CID | 71103102 |
| Molecular Formula | C24H18N4O2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 5-methyl-3-[5-(4-nitrophenyl)-4-phenyl-1H-imidazol-2-yl]-1H-indole |
| SMILES | Cc1ccc2[nH]cc(-c3nc(-c4ccccc4)c(-c4ccc([N+](=O)[O-])cc4)[nH]3)c2c1 |
| InChI | InChI=1S/C24H18N4O2/c1-15-7-12-21-19(13-15)20(14-25-21)24-26-22(16-5-3-2-4-6-16)23(27-24)17-8-10-18(11-9-17)28(29)30/h2-14,25H,1H3,(H,26,27) |
| InChIKey | UVNHERRRWNMKOI-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|