C25H21N3 — CID 142907594
4-methyl-3-[5-(4-methylphenyl)-4-phenyl-1H-imidazol-2-yl]-1H-indole (PubChem CID 142907594) has the molecular formula C25H21N3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 4-methyl-3-[5-(4-methylphenyl)-4-phenyl-1H-imidazol-2-yl]-1H-indole.
| Compound Name | 4-methyl-3-[5-(4-methylphenyl)-4-phenyl-1H-imidazol-2-yl]-1H-indole |
|---|---|
| PubChem CID | 142907594 |
| Molecular Formula | C25H21N3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 4-methyl-3-[5-(4-methylphenyl)-4-phenyl-1H-imidazol-2-yl]-1H-indole |
| SMILES | Cc1ccc(-c2[nH]c(-c3c[nH]c4cccc(C)c34)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H21N3/c1-16-11-13-19(14-12-16)24-23(18-8-4-3-5-9-18)27-25(28-24)20-15-26-21-10-6-7-17(2)22(20)21/h3-15,26H,1-2H3,(H,27,28) |
| InChIKey | SGKGMCCUOFCVPC-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|