C29H28N4 — CID 163720949
5-methyl-3-[4-phenyl-5-(4-piperidin-1-ylphenyl)-1H-imidazol-2-yl]-1H-indole (PubChem CID 163720949) has the molecular formula C29H28N4 and a molecular weight of 432.57 g/mol. Its IUPAC name is 5-methyl-3-[4-phenyl-5-(4-piperidin-1-ylphenyl)-1H-imidazol-2-yl]-1H-indole.
| Compound Name | 5-methyl-3-[4-phenyl-5-(4-piperidin-1-ylphenyl)-1H-imidazol-2-yl]-1H-indole |
|---|---|
| PubChem CID | 163720949 |
| Molecular Formula | C29H28N4 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 5-methyl-3-[4-phenyl-5-(4-piperidin-1-ylphenyl)-1H-imidazol-2-yl]-1H-indole |
| SMILES | Cc1ccc2[nH]cc(-c3nc(-c4ccccc4)c(-c4ccc(N5CCCCC5)cc4)[nH]3)c2c1 |
| InChI | InChI=1S/C29H28N4/c1-20-10-15-26-24(18-20)25(19-30-26)29-31-27(21-8-4-2-5-9-21)28(32-29)22-11-13-23(14-12-22)33-16-6-3-7-17-33/h2,4-5,8-15,18-19,30H,3,6-7,16-17H2,1H3,(H,31,32) |
| InChIKey | KRNMSGUUXXOMLJ-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 47.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|