C19H11N3O2 — CID 788015
8-(4-nitrophenyl)-7H-acenaphthyleno[1,2-d]imidazole (PubChem CID 788015) has the molecular formula C19H11N3O2 and a molecular weight of 313.32 g/mol. Its IUPAC name is 8-(4-nitrophenyl)-7H-acenaphthyleno[1,2-d]imidazole.
| Compound Name | 8-(4-nitrophenyl)-7H-acenaphthyleno[1,2-d]imidazole |
|---|---|
| PubChem CID | 788015 |
| Molecular Formula | C19H11N3O2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 8-(4-nitrophenyl)-7H-acenaphthyleno[1,2-d]imidazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nc3c([nH]2)-c2cccc4cccc-3c24)cc1 |
| InChI | InChI=1S/C19H11N3O2/c23-22(24)13-9-7-12(8-10-13)19-20-17-14-5-1-3-11-4-2-6-15(16(11)14)18(17)21-19/h1-10H,(H,20,21) |
| InChIKey | HXMJYUDWPACKJN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|